![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 120414_LandGrabbing_FIAN.mp3 | 2015-08-20 18:07 | 10M | |
| 130209_cap.mp3 | 2015-08-20 18:07 | 17M | |
| 130504_Zaadgoedrichtlijn_VELT.mp3 | 2015-08-20 18:07 | 11M | |
| 130525_sunita.mp3 | 2015-08-20 18:07 | 12M | |
| 130928_monsanto.mp3 | 2015-08-20 18:07 | 10M | |
| 131019_Rajagopal.mp3 | 2015-08-20 18:07 | 11M | |
| 131019_rajagopal_volledig.mp3 | 2015-08-20 18:07 | 23M | |
| 140201_zaden.mp3 | 2015-08-20 18:07 | 5.8M | |
| 140329_colombia.mp3 | 2015-08-20 18:07 | 5.0M | |
| 20140705-Aryal-philippines6months-en.mp3 | 2015-08-20 18:07 | 3.5M | |
| AGRICULTURA FAMILIAR.mp3 | 2015-08-20 18:07 | 14M | |
| Comer Para Vivir/ | 2015-08-20 18:07 | - | |
| Krishak utpadak Compniyon se Labh kese prapt karen.mp3 | 2015-08-20 18:07 | 14M | |
| MAGAZINE INSECURITE DES AGRICULTEURS A BENI .mp3 | 2015-08-20 18:07 | 3.5M | |
| Radio Gurune 99.3fm Ghana- samll household Food security the challenge of climate change.MP3 | 2015-08-20 18:07 | 1.9M | |
| genhu ki fasal ki katai avam bhandaran ke surakshit tarike_mixdown.mp3 | 2015-08-20 18:07 | 16M | |
| genhu ki narwai_mixdown.mp3 | 2015-08-20 18:07 | 14M | |